Glorianapena6 Glorianapena6

01-10-2020
Biology

contestada

An atom that has gained or lost electrons is called?
a molecule
inert
an ion
a cation

Respuesta :

DeFadedBolt256 DeFadedBolt256

01-10-2020

A molecule csnsjsnsjejsjsjsjsjsjsjhshdjsjsns

Answer Link

Otras preguntas

Which goal is a behavioral therapist least likely to have when treating a socially anxious person?

What is the total energy transported per hour along a narrow cylindrical laser beam 2. 40 mm in diameter, whose b-field has an rms strength of 1. 30×10−10 t?

Why are assemblages of fossils seen in successive geological periods so different?

The most biologically devastating oil spills in the marine environment are usually a result of?

_____________ is a serious breach that results in harm to clients and is therefore unethical.

Write about the Indian Female Freedom fighters in Hindi . * For more information kindly take a look at the the picture attached above * The one who answers Righ

Cognitively, people with borderline personality disorder are ________ negative emotional stimuli in the environment. less aware of hyperattentive to avoidant of

Draw the products formed when each ester is treated with lithium hydroxide and water. ch3ch2ch(ch3)oc=och(ch3)2−→−−h2olioh

The probability that a rental car will be stolen is. 4. if 3500 cars are rented, what is the approximate poisson probability that 2 or fewer will be stolen?

An objective of the __________ is to provide a standardized set of i/o interface routines to user processes