sherrydumanew sherrydumanew

02-11-2020
Business

contestada

For the same example as (1), what is the markup if the price is $89 and the cost is $72? Please round your answer to the nearest tenth of a percent

Respuesta :

Samawati Samawati

03-11-2020

Answer:

23.6%

Explanation:

The price is $89

The cost is $72

mark-up in dollars price -cost

= $89-72

=$17

As a percentage

=$17/72 x 100

=0.23611 x 100

=23.6 %

Answer Link

Otras preguntas

What is the balanced ionic equation for the reaction HCHO2 (aq) + KOH (aq)

Given that y and x are directly proportional and y=2 when x=7, find the value of y when x=17.5.

Find the sum of all positive divisors of 50 that are also divisors of 15. Pls

Value of x when 6-2x=6x-10x+6

Two are used to fill the swimming pool.Pipe A alone fill the tank in 4 hours and pipe B fill the tank in 4 hours.If both pipe s together filled A can turned on

At one point in our country's history (in the usa) slavery almost died out on its own due to what?A.Federal laws prohibiting slavery.B.The federal government ba

cosec(6b+pi/8)=sec(2b-pi/8)

Find the y-coordinate of the vertex: f(2) = 2^2- 4(2) - 5.

how does night be warm when the day is cool?

what is the slope of 2x-3