raaeraae22
raaeraae22 raaeraae22
  • 04-02-2017
  • Chemistry
contestada

When is di- used in the name of a hydrocarbon?

Respuesta :

DoctorCass
DoctorCass DoctorCass
  • 04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link

Otras preguntas

What are some possible benefits to a nomadic lifestyle, and what are some possible benefits of a town lifestyle?
what is 1/7 divided by 7
Evaluate the expression 14!/12!2!
on what continents would you expect to see evidence of a glacier
Around the year 1000, Songhai’s leader converted to _____________________________, but most of the people continued to worship ________________________________.
what was the result of the peloponnesian war?
Which most accurately describes the "mandate of heaven"? The Zhou Dynasty’s justification for its leadership A new religion The philosophy of Confucius A holy b
when and where was Hernando de Soto born
What does this poem mean "pretty girl, with faraway eyes, why do you look with such surprise? How did you get to be so wise, old girl in young-girl disguise"
Which animal could a bulldog mate with to produce offspring? A. sheepdog B. beaver C. raccoon D. tabby cat