miracle420 miracle420

01-05-2020
Mathematics

contestada

{(1, 3), (1, 2), (2, 4), (3, 2)}
Function
Not a Function

Respuesta :

erikar14 erikar14

01-05-2020

Step-by-step explanation:

no its not a function because the y axis can not be the same number

Answer Link

Otras preguntas

Tracie wants to verify the meaning of the word betray. which portion of the entry best allows her to do this? v. \bē-'tra\ 1. to lead astray middle english, fro

When you created hypotheses to guess whether each chemical was an acid or base, what specifically did you look for in the chemical formulas?

Photosynthetic and chemosynthetic organisms can be called primary producers because they make their own food?

how is that velocity got like this? pls explain

Which key term is part of the ideation process? a) budgeting b) sticky notes c) critique d) thumbnail drawing

The 10-lb block has a speed of 4 ft/s when the force of f=(8t2)f=(8t2) lb is applied. determine the velocity of the block when t == 2 s. the coefficient of kine

Which theistic term refers to the belief that sacred reality or god participates in all things and, conversely, that all things participate in god or sacred rea

Draw the products formed when each ester is treated with lithium hydroxide and water. ch3ch2ch(ch3)oc=och(ch3)2−→−−h2olioh

A firm may opt to pay millions of dollars for celebrity endorsements in order to:_____

Macro events only are reflected in the performance of the market portfolio because_________.