sgbc2004 sgbc2004

03-03-2021
English

contestada

Whatcha of the following is an example of a reaction of fear

Respuesta :

singhvinod8802 singhvinod8802

07-03-2021

Answer:

Reaction of Fear.

Explanation:

The definition of fear is an emotion caused by anxiety or the uneasiness of being afraid of something or someone. an example of fear is the feeling felt in a haunted house.

Answer Link

Otras preguntas

¿Cuál es una manera de propagación del dengue? Usar el mismo vaso todos los días. Dejar que los mosquitos te piquen. Tomar agua contaminada.

Consider the diagram that depicts the lysogenic and lytic cycle. In which step of the diagram is the provirus formed? Step A Step B Step E Step F

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Air, water, light, temperature and pH makes up the biotic environment abiotic environment ecosystem food chain

Which is a fundamental principle of the Washington state constitution? A. The citizens serve the government B. The executive branch is the most powerful C. Th

What is the minimum number of bits required to store each binary string of length 50? (b) what is the minimum number of bits required to store each number with

In julius caesar act ii, who has a recurring dream about caesar being murdered?

Be-1 where on the boat are registration numbers placed?

A polyhedron has 8 vertices and 14 edges. How many faces must it have?

Do hysterectomy surgery include taking out the ovaries