777nono
777nono 777nono
  • 05-04-2022
  • Mathematics
contestada

Apples cost $1.10 per pound. Darius bought x pounds of apples for a total cost of $2.75.

Respuesta :

sub4sublagging sub4sublagging
  • 05-04-2022
X= 2.5 2.75 divided by 1.10 =2.5
Answer Link

Otras preguntas

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)
Which type of poetry does Wesley use when she creates her own structure?
Assume that A varies directly with z. If A = 30 when z = 5, find A when z = 9.
Each week you drive 150 miles your car gets 25 miles a gallon and gas prices are three dollars per gallon how much gas will you spend on gas each week
Help needed Factor 2a^2 b - 6ab^2 + 12a^2 b^2 by separating the GCF.
What are two types of ways organisms can reproduce? what are the advantages and disadvantages to each?
There are more hydrogen Atom in living organisms than any other Atom
which product would form if chlorine gas was bubbled through a solution of sodium bromide
What is the greatest common factor of 48, 72 and 52?A.2B.4C.8D.16
Should the response be yes or no?