Yavian47
Yavian47 Yavian47
  • 04-03-2017
  • Mathematics
contestada

How manny cups does 240 fl oz=?

Respuesta :

quickstudent
quickstudent quickstudent
  • 04-03-2017
Since one cup = 8 fl oz

divide 240/8 = 30

There are 30 cups in 240 fl oz.
Answer Link

Otras preguntas

What effect does the diameter of the string have on the lever arm? explain why we can ignore this effect
More strong base is added until the equivalence point is reached. what is the ph of this solution at the equivalence point if the total volume is 57. 0 mlml ?
Explain insurable interest and give an example
What would the speed of an observer be if a red (4. 688 × 1014 hz) traffic light appeared green (5. 555 × 1014 hz) to the observer?
Draw the products formed when each ester is treated with lithium hydroxide and water. ch3ch2ch(ch3)oc=och(ch3)2−→−−h2olioh
______ policing relies on data collection and analytics that target current and future crime trends
At what point in the story does Milo’s world shift from reality to fantasy?
In some cultures, employees have a great deal of respect for persons in positions of authority. This cultural dimension is called?
(-4) (-2) +2 (6+5) if anyone knows pls tell due dates tomm for homeworkThanks,Unknownaz05​
) a student makes up a 0. 6 m solution of acetic acid. (note: the pka of acetic acid is 4. 74) a) what is the poh of this solution?