leslievanwinkle
leslievanwinkle leslievanwinkle
  • 02-04-2018
  • Mathematics
contestada

I can’t figure this out at all.

I cant figure this out at all class=

Respuesta :

ramaaabdou
ramaaabdou ramaaabdou
  • 02-04-2018
The fact that this triangle is a right angle triangle makes you now have 2 angles and the 1 side given, so it should be solvable.
First, You know that A=46 and C=90 as it is the right angle, and you know that the sum of any triangle's angles is 180. so now B=180-(90-46)=44
Now to the sides,
sin(B)=opp./hyp.=b/c=8/c=sin(44)
so, c=8/sin(44) which is approximately 11.52 unit length
now, use Pythagoras to find a,
a=√c²-b² =√11.52²-8² which is approximately 8.3 unit length.
Hope this helps.

Answer Link

Otras preguntas

why did el patron save matt’s brain in the first place
What measurement could be the length of a pool?
3. How can this sentence be changed into a compound sentence? Wildflowers grew in the back corner of the abandoned lot. • A. Add a comma, the conjunction but an
Can someone help me out with this question fast!?!?!
What happens to earnings in a cooperative?
70 POINTS!!!! This is my fourth time asking, PLEASE HElP!!! What is the domain of the following points?(The following points are on the image below) A {-7, 3, 7
How do you drown a blonde?
HELP ME PLEASE WITH THIS MATH PROBLEM
How can this sentence be changed into a simple sentence? The ski club members are raising money for a trip to Aspen, but they will probably pay most of the expe
What is the formula of Sodium Sulfide? A) Na3S₂ B) NaS₂ C) Na₂S D) Nas